C15H14F2N6O2S — CID 122292893
3,5-difluoro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122292893) has the molecular formula C15H14F2N6O2S and a molecular weight of 380.38 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122292893 |
| Molecular Formula | C15H14F2N6O2S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 3,5-difluoro-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(-n2cccn2)nn1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H14F2N6O2S/c16-11-8-12(17)10-13(9-11)26(24,25)20-6-5-18-14-2-3-15(22-21-14)23-7-1-4-19-23/h1-4,7-10,20H,5-6H2,(H,18,21) |
| InChIKey | WQYSTJYLQHVOKB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|