C18H20F2N6O2S — CID 122323949
3,5-difluoro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122323949) has the molecular formula C18H20F2N6O2S and a molecular weight of 422.46 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3,5-difluoro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122323949 |
| Molecular Formula | C18H20F2N6O2S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3,5-difluoro-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | Cc1nn(-c2ccc(NCCNS(=O)(=O)c3cc(F)cc(F)c3)nn2)c(C)c1C |
| InChI | InChI=1S/C18H20F2N6O2S/c1-11-12(2)25-26(13(11)3)18-5-4-17(23-24-18)21-6-7-22-29(27,28)16-9-14(19)8-15(20)10-16/h4-5,8-10,22H,6-7H2,1-3H3,(H,21,23) |
| InChIKey | YUAJWGJAPKYUGT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|