C19H23FN6O3S — CID 122323958
3-fluoro-4-methoxy-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122323958) has the molecular formula C19H23FN6O3S and a molecular weight of 434.50 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 3-fluoro-4-methoxy-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122323958 |
| Molecular Formula | C19H23FN6O3S |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNc2ccc(-n3nc(C)c(C)c3C)nn2)cc1F |
| InChI | InChI=1S/C19H23FN6O3S/c1-12-13(2)25-26(14(12)3)19-8-7-18(23-24-19)21-9-10-22-30(27,28)15-5-6-17(29-4)16(20)11-15/h5-8,11,22H,9-10H2,1-4H3,(H,21,23) |
| InChIKey | ZTABHDUENILTQU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|