C21H27N7O3S — CID 122323971
N-[3-methyl-4-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]phenyl]acetamide (PubChem CID 122323971) has the molecular formula C21H27N7O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-[3-methyl-4-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]phenyl]acetamide.
| Compound Name | N-[3-methyl-4-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 122323971 |
| Molecular Formula | C21H27N7O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-[3-methyl-4-[2-[[6-(3,4,5-trimethylpyrazol-1-yl)pyridazin-3-yl]amino]ethylsulfamoyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCNc2ccc(-n3nc(C)c(C)c3C)nn2)c(C)c1 |
| InChI | InChI=1S/C21H27N7O3S/c1-13-12-18(24-17(5)29)6-7-19(13)32(30,31)23-11-10-22-20-8-9-21(26-25-20)28-16(4)14(2)15(3)27-28/h6-9,12,23H,10-11H2,1-5H3,(H,22,25)(H,24,29) |
| InChIKey | ZQWIDTCTSVGIPM-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|