C20H20N8O2S — CID 122289030
4-pyrazol-1-yl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide (PubChem CID 122289030) has the molecular formula C20H20N8O2S and a molecular weight of 436.50 g/mol. Its IUPAC name is 4-pyrazol-1-yl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide.
| Compound Name | 4-pyrazol-1-yl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122289030 |
| Molecular Formula | C20H20N8O2S |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 4-pyrazol-1-yl-N-[2-[[6-(pyridin-2-ylamino)pyridazin-3-yl]amino]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCNc1ccc(Nc2ccccn2)nn1)c1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C20H20N8O2S/c29-31(30,17-7-5-16(6-8-17)28-15-3-12-23-28)24-14-13-22-19-9-10-20(27-26-19)25-18-4-1-2-11-21-18/h1-12,15,24H,13-14H2,(H,22,26)(H,21,25,27) |
| InChIKey | CDXLLWORRAPJNY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 126.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|