C16H15N7O2S — CID 122292941
4-cyano-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide (PubChem CID 122292941) has the molecular formula C16H15N7O2S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-cyano-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-cyano-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 122292941 |
| Molecular Formula | C16H15N7O2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-cyano-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCNc2ccc(-n3cccn3)nn2)cc1 |
| InChI | InChI=1S/C16H15N7O2S/c17-12-13-2-4-14(5-3-13)26(24,25)20-10-9-18-15-6-7-16(22-21-15)23-11-1-8-19-23/h1-8,11,20H,9-10H2,(H,18,21) |
| InChIKey | LDBISMQGGMQQBB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|