C9H11N5 — CID 130693230
N-ethyl-6-pyrazol-1-ylpyridazin-3-amine (PubChem CID 130693230) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is N-ethyl-6-pyrazol-1-ylpyridazin-3-amine.
| Compound Name | N-ethyl-6-pyrazol-1-ylpyridazin-3-amine |
|---|---|
| PubChem CID | 130693230 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-ethyl-6-pyrazol-1-ylpyridazin-3-amine |
| SMILES | CCNc1ccc(-n2cccn2)nn1 |
| InChI | InChI=1S/C9H11N5/c1-2-10-8-4-5-9(13-12-8)14-7-3-6-11-14/h3-7H,2H2,1H3,(H,10,12) |
| InChIKey | IJRSWLQPFJZNDT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |