C13H19N7O3S — CID 122292782
2-[methyl(methylsulfonyl)amino]-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide (PubChem CID 122292782) has the molecular formula C13H19N7O3S and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[methyl(methylsulfonyl)amino]-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide.
| Compound Name | 2-[methyl(methylsulfonyl)amino]-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 122292782 |
| Molecular Formula | C13H19N7O3S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[methyl(methylsulfonyl)amino]-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]acetamide |
| SMILES | CN(CC(=O)NCCNc1ccc(-n2cccn2)nn1)S(C)(=O)=O |
| InChI | InChI=1S/C13H19N7O3S/c1-19(24(2,22)23)10-13(21)15-8-7-14-11-4-5-12(18-17-11)20-9-3-6-16-20/h3-6,9H,7-8,10H2,1-2H3,(H,14,17)(H,15,21) |
| InChIKey | ZYBHZXMDPYJQON-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|