C18H19ClN6O — CID 122292804
3-(3-chlorophenyl)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]propanamide (PubChem CID 122292804) has the molecular formula C18H19ClN6O and a molecular weight of 370.84 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 122292804 |
| Molecular Formula | C18H19ClN6O |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)NCCNc1ccc(-n2cccn2)nn1 |
| InChI | InChI=1S/C18H19ClN6O/c19-15-4-1-3-14(13-15)5-8-18(26)21-11-10-20-16-6-7-17(24-23-16)25-12-2-9-22-25/h1-4,6-7,9,12-13H,5,8,10-11H2,(H,20,23)(H,21,26) |
| InChIKey | LZSHHPAMPUDZDU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|