C19H21N7O3 — CID 122292820
benzyl N-[2-oxo-2-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethylamino]ethyl]carbamate (PubChem CID 122292820) has the molecular formula C19H21N7O3 and a molecular weight of 395.42 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethylamino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 122292820 |
| Molecular Formula | C19H21N7O3 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | benzyl N-[2-oxo-2-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethylamino]ethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)NCCNc1ccc(-n2cccn2)nn1 |
| InChI | InChI=1S/C19H21N7O3/c27-18(13-22-19(28)29-14-15-5-2-1-3-6-15)21-11-10-20-16-7-8-17(25-24-16)26-12-4-9-23-26/h1-9,12H,10-11,13-14H2,(H,20,24)(H,21,27)(H,22,28) |
| InChIKey | JROQVTJAGZUBGM-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|