C23H21N7O3 — CID 122292113
benzyl N-[2-oxo-2-[4-[(6-pyrazol-1-ylpyridazin-3-yl)amino]anilino]ethyl]carbamate (PubChem CID 122292113) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[4-[(6-pyrazol-1-ylpyridazin-3-yl)amino]anilino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[4-[(6-pyrazol-1-ylpyridazin-3-yl)amino]anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 122292113 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | benzyl N-[2-oxo-2-[4-[(6-pyrazol-1-ylpyridazin-3-yl)amino]anilino]ethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)Nc1ccc(Nc2ccc(-n3cccn3)nn2)cc1 |
| InChI | InChI=1S/C23H21N7O3/c31-22(15-24-23(32)33-16-17-5-2-1-3-6-17)27-19-9-7-18(8-10-19)26-20-11-12-21(29-28-20)30-14-4-13-25-30/h1-14H,15-16H2,(H,24,32)(H,26,28)(H,27,31) |
| InChIKey | ZDXWLVQLAKEQKF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |