C18H17ClN2O5 — CID 70183843
chloromethyl 4-[[2-(phenylmethoxycarbonylamino)acetyl]amino]benzoate (PubChem CID 70183843) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is chloromethyl 4-[[2-(phenylmethoxycarbonylamino)acetyl]amino]benzoate.
| Compound Name | chloromethyl 4-[[2-(phenylmethoxycarbonylamino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 70183843 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | chloromethyl 4-[[2-(phenylmethoxycarbonylamino)acetyl]amino]benzoate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)Nc1ccc(C(=O)OCCl)cc1 |
| InChI | InChI=1S/C18H17ClN2O5/c19-12-26-17(23)14-6-8-15(9-7-14)21-16(22)10-20-18(24)25-11-13-4-2-1-3-5-13/h1-9H,10-12H2,(H,20,24)(H,21,22) |
| InChIKey | RTYKYGGGYHBUJD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|