C25H21N3O3S — CID 58874869
benzyl N-[2-oxo-2-[4-(2-phenyl-1,3-thiazol-4-yl)anilino]ethyl]carbamate (PubChem CID 58874869) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is benzyl N-[2-oxo-2-[4-(2-phenyl-1,3-thiazol-4-yl)anilino]ethyl]carbamate.
| Compound Name | benzyl N-[2-oxo-2-[4-(2-phenyl-1,3-thiazol-4-yl)anilino]ethyl]carbamate |
|---|---|
| PubChem CID | 58874869 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | benzyl N-[2-oxo-2-[4-(2-phenyl-1,3-thiazol-4-yl)anilino]ethyl]carbamate |
| SMILES | O=C(CNC(=O)OCc1ccccc1)Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c29-23(15-26-25(30)31-16-18-7-3-1-4-8-18)27-21-13-11-19(12-14-21)22-17-32-24(28-22)20-9-5-2-6-10-20/h1-14,17H,15-16H2,(H,26,30)(H,27,29) |
| InChIKey | VWUBEZDNQOCQQF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |