C26H22N2O2S — CID 108727454
4-(4-methylphenyl)-4-oxo-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 108727454) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is 4-(4-methylphenyl)-4-oxo-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | 4-(4-methylphenyl)-4-oxo-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 108727454 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 4-(4-methylphenyl)-4-oxo-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O2S/c1-18-7-9-20(10-8-18)24(29)15-16-25(30)27-22-13-11-19(12-14-22)23-17-31-26(28-23)21-5-3-2-4-6-21/h2-14,17H,15-16H2,1H3,(H,27,30) |
| InChIKey | BCUZJYZZNAOCIU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |