C27H21N3O3S — CID 108751433
4-(1,3-dioxoisoindol-2-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 108751433) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 108751433 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H21N3O3S/c31-24(11-6-16-30-26(32)21-9-4-5-10-22(21)27(30)33)28-20-14-12-18(13-15-20)23-17-34-25(29-23)19-7-2-1-3-8-19/h1-5,7-10,12-15,17H,6,11,16H2,(H,28,31) |
| InChIKey | ZOYGONZCEPKNNE-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|