C29H24N2O2S — CID 108751489
4-naphthalen-2-yloxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide (PubChem CID 108751489) has the molecular formula C29H24N2O2S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-naphthalen-2-yloxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide.
| Compound Name | 4-naphthalen-2-yloxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 108751489 |
| Molecular Formula | C29H24N2O2S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 4-naphthalen-2-yloxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]butanamide |
| SMILES | O=C(CCCOc1ccc2ccccc2c1)Nc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C29H24N2O2S/c32-28(11-6-18-33-26-17-14-21-7-4-5-10-24(21)19-26)30-25-15-12-22(13-16-25)27-20-34-29(31-27)23-8-2-1-3-9-23/h1-5,7-10,12-17,19-20H,6,11,18H2,(H,30,32) |
| InChIKey | VQPIEPGGCKCZFK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|