C23H19N3O2S — CID 108748690
3-phenoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide (PubChem CID 108748690) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is 3-phenoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide.
| Compound Name | 3-phenoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 108748690 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 3-phenoxy-N-[3-(2-pyridin-4-yl-1,3-thiazol-4-yl)phenyl]propanamide |
| SMILES | O=C(CCOc1ccccc1)Nc1cccc(-c2csc(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C23H19N3O2S/c27-22(11-14-28-20-7-2-1-3-8-20)25-19-6-4-5-18(15-19)21-16-29-23(26-21)17-9-12-24-13-10-17/h1-10,12-13,15-16H,11,14H2,(H,25,27) |
| InChIKey | YTFWTAFAFXORKC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |