About benzyl 4-formamidobenzoate
benzyl 4-formamidobenzoate (PubChem CID 100979442) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is benzyl 4-formamidobenzoate.
Molecular Properties
| Compound Name | benzyl 4-formamidobenzoate |
| PubChem CID | 100979442 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | benzyl 4-formamidobenzoate |
| SMILES | O=CNc1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C15H13NO3/c17-11-16-14-8-6-13(7-9-14)15(18)19-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,16,17) |
| InChIKey | YRNIDXVWFGXAFI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-formamidobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-formamidobenzoate?
The IUPAC name of benzyl 4-formamidobenzoate (CID 100979442) is benzyl 4-formamidobenzoate.
What is the SMILES notation for benzyl 4-formamidobenzoate?
The canonical SMILES for benzyl 4-formamidobenzoate is O=CNc1ccc(C(=O)OCc2ccccc2)cc1.
What is the InChIKey of benzyl 4-formamidobenzoate?
The InChIKey is YRNIDXVWFGXAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-11-16-14-8-6-13(7-9-14)15(18)19-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,16,17).
What are the key properties of benzyl 4-formamidobenzoate?
benzyl 4-formamidobenzoate has a molecular weight of 255.27 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-formamidobenzoate is sourced from PubChem (CID 100979442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).