C34H32N2O7 — CID 139643103
benzyl 4-[[(4S)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoyl]amino]benzoate (PubChem CID 139643103) has the molecular formula C34H32N2O7 and a molecular weight of 580.64 g/mol. Its IUPAC name is benzyl 4-[[(4S)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoyl]amino]benzoate.
| Compound Name | benzyl 4-[[(4S)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 139643103 |
| Molecular Formula | C34H32N2O7 |
| Molecular Weight | 580.64 g/mol |
| Exact Mass | 580.22 |
| IUPAC Name | benzyl 4-[[(4S)-5-oxo-5-phenylmethoxy-4-(phenylmethoxycarbonylamino)pentanoyl]amino]benzoate |
| SMILES | O=C(CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)Nc1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C34H32N2O7/c37-31(35-29-18-16-28(17-19-29)32(38)41-22-25-10-4-1-5-11-25)21-20-30(33(39)42-23-26-12-6-2-7-13-26)36-34(40)43-24-27-14-8-3-9-15-27/h1-19,30H,20-24H2,(H,35,37)(H,36,40)/t30-/m0/s1 |
| InChIKey | TWOMGKYAVPBPSI-PMERELPUSA-N |
| XLogP | 5.80 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|