C23H26N2O5 — CID 155726369
benzyl (2S)-5-(cyclopropylamino)-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 155726369) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is benzyl (2S)-5-(cyclopropylamino)-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | benzyl (2S)-5-(cyclopropylamino)-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 155726369 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | benzyl (2S)-5-(cyclopropylamino)-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | O=C(CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)NC1CC1 |
| InChI | InChI=1S/C23H26N2O5/c26-21(24-19-11-12-19)14-13-20(22(27)29-15-17-7-3-1-4-8-17)25-23(28)30-16-18-9-5-2-6-10-18/h1-10,19-20H,11-16H2,(H,24,26)(H,25,28)/t20-/m0/s1 |
| InChIKey | SCWMBRBXXJIXHR-FQEVSTJZSA-N |
| XLogP | 3.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |