C18H26N2O3 — CID 18106493
benzyl N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]carbamate (PubChem CID 18106493) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18106493 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | benzyl N-[(2S)-1-[(4-methylcyclohexyl)amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC1CCC(NC(=O)[C@H](C)NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-8-10-16(11-9-13)20-17(21)14(2)19-18(22)23-12-15-6-4-3-5-7-15/h3-7,13-14,16H,8-12H2,1-2H3,(H,19,22)(H,20,21)/t13?,14-,16?/m0/s1 |
| InChIKey | ZQBFUYOABMHBQJ-BBBYJDLNSA-N |
| XLogP | 3.00 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |