C17H16F3N7O2 — CID 122292701
1-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122292701) has the molecular formula C17H16F3N7O2 and a molecular weight of 407.36 g/mol. Its IUPAC name is 1-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122292701 |
| Molecular Formula | C17H16F3N7O2 |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[2-[(6-pyrazol-1-ylpyridazin-3-yl)amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCCNc1ccc(-n2cccn2)nn1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C17H16F3N7O2/c18-17(19,20)29-13-5-2-1-4-12(13)24-16(28)22-10-9-21-14-6-7-15(26-25-14)27-11-3-8-23-27/h1-8,11H,9-10H2,(H,21,25)(H2,22,24,28) |
| InChIKey | AVSHAMAYXQIHGT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 105.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|