C17H21F3N6O2 — CID 122293561
1-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122293561) has the molecular formula C17H21F3N6O2 and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122293561 |
| Molecular Formula | C17H21F3N6O2 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-[2-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]ethyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccccc2OC(F)(F)F)cc(N(C)C)n1 |
| InChI | InChI=1S/C17H21F3N6O2/c1-11-23-14(10-15(24-11)26(2)3)21-8-9-22-16(27)25-12-6-4-5-7-13(12)28-17(18,19)20/h4-7,10H,8-9H2,1-3H3,(H,21,23,24)(H2,22,25,27) |
| InChIKey | UFLNAWKFVIFLAI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|