C16H18F3N5O2 — CID 122353945
1-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122353945) has the molecular formula C16H18F3N5O2 and a molecular weight of 369.35 g/mol. Its IUPAC name is 1-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122353945 |
| Molecular Formula | C16H18F3N5O2 |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1cc(CNC(=O)Nc2ccccc2OC(F)(F)F)nc(N(C)C)n1 |
| InChI | InChI=1S/C16H18F3N5O2/c1-10-8-11(22-14(21-10)24(2)3)9-20-15(25)23-12-6-4-5-7-13(12)26-16(17,18)19/h4-8H,9H2,1-3H3,(H2,20,23,25) |
| InChIKey | WRFCNJUSNJYZGC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |