C18H20F3N5O3 — CID 122353652
1-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 122353652) has the molecular formula C18H20F3N5O3 and a molecular weight of 411.38 g/mol. Its IUPAC name is 1-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 122353652 |
| Molecular Formula | C18H20F3N5O3 |
| Molecular Weight | 411.38 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1cc(CNC(=O)Nc2ccccc2OC(F)(F)F)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H20F3N5O3/c1-12-10-13(24-16(23-12)26-6-8-28-9-7-26)11-22-17(27)25-14-4-2-3-5-15(14)29-18(19,20)21/h2-5,10H,6-9,11H2,1H3,(H2,22,25,27) |
| InChIKey | YVHCSMAFSMOTJZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |