C18H19F3N4O3 — CID 122353733
N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-(trifluoromethoxy)benzamide (PubChem CID 122353733) has the molecular formula C18H19F3N4O3 and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 122353733 |
| Molecular Formula | C18H19F3N4O3 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | N-[(6-methyl-2-morpholin-4-ylpyrimidin-4-yl)methyl]-4-(trifluoromethoxy)benzamide |
| SMILES | Cc1cc(CNC(=O)c2ccc(OC(F)(F)F)cc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H19F3N4O3/c1-12-10-14(24-17(23-12)25-6-8-27-9-7-25)11-22-16(26)13-2-4-15(5-3-13)28-18(19,20)21/h2-5,10H,6-9,11H2,1H3,(H,22,26) |
| InChIKey | UEJAYQCDDQGOFK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |