C16H14F4N2O2 — CID 3594769
1-[(5-fluoro-2-methylphenyl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 3594769) has the molecular formula C16H14F4N2O2 and a molecular weight of 342.29 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylphenyl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(5-fluoro-2-methylphenyl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 3594769 |
| Molecular Formula | C16H14F4N2O2 |
| Molecular Weight | 342.29 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 1-[(5-fluoro-2-methylphenyl)methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | Cc1ccc(F)cc1CNC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H14F4N2O2/c1-10-6-7-12(17)8-11(10)9-21-15(23)22-13-4-2-3-5-14(13)24-16(18,19)20/h2-8H,9H2,1H3,(H2,21,22,23) |
| InChIKey | GCFPYMILNBZSOH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |