C16H11F7N2O2 — CID 3728140
1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 3728140) has the molecular formula C16H11F7N2O2 and a molecular weight of 396.26 g/mol. Its IUPAC name is 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 3728140 |
| Molecular Formula | C16H11F7N2O2 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(NCc1cc(F)cc(C(F)(F)F)c1)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H11F7N2O2/c17-11-6-9(5-10(7-11)15(18,19)20)8-24-14(26)25-12-3-1-2-4-13(12)27-16(21,22)23/h1-7H,8H2,(H2,24,25,26) |
| InChIKey | HHSHEODSJVQRJC-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |