C14H19F3N2O3 — CID 111431252
1-(2-hydroxy-3,3-dimethylbutyl)-3-[2-(trifluoromethoxy)phenyl]urea (PubChem CID 111431252) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-(2-hydroxy-3,3-dimethylbutyl)-3-[2-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(2-hydroxy-3,3-dimethylbutyl)-3-[2-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 111431252 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(2-hydroxy-3,3-dimethylbutyl)-3-[2-(trifluoromethoxy)phenyl]urea |
| SMILES | CC(C)(C)C(O)CNC(=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C14H19F3N2O3/c1-13(2,3)11(20)8-18-12(21)19-9-6-4-5-7-10(9)22-14(15,16)17/h4-7,11,20H,8H2,1-3H3,(H2,18,19,21) |
| InChIKey | SJMKAZCSLTZJEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |