C10H9F6NO2 — CID 22675955
1,1,1-trifluoro-3-[2-(trifluoromethoxy)anilino]propan-2-ol (PubChem CID 22675955) has the molecular formula C10H9F6NO2 and a molecular weight of 289.18 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-(trifluoromethoxy)anilino]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-[2-(trifluoromethoxy)anilino]propan-2-ol |
|---|---|
| PubChem CID | 22675955 |
| Molecular Formula | C10H9F6NO2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-(trifluoromethoxy)anilino]propan-2-ol |
| SMILES | OC(CNc1ccccc1OC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H9F6NO2/c11-9(12,13)8(18)5-17-6-3-1-2-4-7(6)19-10(14,15)16/h1-4,8,17-18H,5H2 |
| InChIKey | RQGDUQZDCHVUHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |