C11H13F4NO3 — CID 168596052
3-[2-(1,1,2,2-tetrafluoroethoxy)anilino]propane-1,2-diol (PubChem CID 168596052) has the molecular formula C11H13F4NO3 and a molecular weight of 283.22 g/mol. Its IUPAC name is 3-[2-(1,1,2,2-tetrafluoroethoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[2-(1,1,2,2-tetrafluoroethoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168596052 |
| Molecular Formula | C11H13F4NO3 |
| Molecular Weight | 283.22 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[2-(1,1,2,2-tetrafluoroethoxy)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C11H13F4NO3/c12-10(13)11(14,15)19-9-4-2-1-3-8(9)16-5-7(18)6-17/h1-4,7,10,16-18H,5-6H2 |
| InChIKey | UOIZMZDVIYRWOX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.22 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|