C15H19NO3S — CID 168595930
3-[2-(2-thiophen-2-ylethoxy)anilino]propane-1,2-diol (PubChem CID 168595930) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-[2-(2-thiophen-2-ylethoxy)anilino]propane-1,2-diol.
| Compound Name | 3-[2-(2-thiophen-2-ylethoxy)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168595930 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-[2-(2-thiophen-2-ylethoxy)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1ccccc1OCCc1cccs1 |
| InChI | InChI=1S/C15H19NO3S/c17-11-12(18)10-16-14-5-1-2-6-15(14)19-8-7-13-4-3-9-20-13/h1-6,9,12,16-18H,7-8,10-11H2 |
| InChIKey | UREBHXHPICJKFR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_alk_E(1)', 'substructure': 'N/A'} |
|---|