C11H17NO3S — CID 66178126
N-(2,3-dihydroxypropyl)-4-thiophen-2-ylbutanamide (PubChem CID 66178126) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4-thiophen-2-ylbutanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 66178126 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4-thiophen-2-ylbutanamide |
| SMILES | O=C(CCCc1cccs1)NCC(O)CO |
| InChI | InChI=1S/C11H17NO3S/c13-8-9(14)7-12-11(15)5-1-3-10-4-2-6-16-10/h2,4,6,9,13-14H,1,3,5,7-8H2,(H,12,15) |
| InChIKey | NOPCPPGMINACNW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |