C13H19NO3 — CID 66177076
N-(2,3-dihydroxypropyl)-4-phenylbutanamide (PubChem CID 66177076) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-4-phenylbutanamide.
| Compound Name | N-(2,3-dihydroxypropyl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 66177076 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-4-phenylbutanamide |
| SMILES | O=C(CCCc1ccccc1)NCC(O)CO |
| InChI | InChI=1S/C13H19NO3/c15-10-12(16)9-14-13(17)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,12,15-16H,4,7-10H2,(H,14,17) |
| InChIKey | WWEGSGOXSHXKMS-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |