C15H23NO3 — CID 168596583
3-(2-cyclohexyloxyanilino)propane-1,2-diol (PubChem CID 168596583) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 3-(2-cyclohexyloxyanilino)propane-1,2-diol.
| Compound Name | 3-(2-cyclohexyloxyanilino)propane-1,2-diol |
|---|---|
| PubChem CID | 168596583 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-(2-cyclohexyloxyanilino)propane-1,2-diol |
| SMILES | OCC(O)CNc1ccccc1OC1CCCCC1 |
| InChI | InChI=1S/C15H23NO3/c17-11-12(18)10-16-14-8-4-5-9-15(14)19-13-6-2-1-3-7-13/h4-5,8-9,12-13,16-18H,1-3,6-7,10-11H2 |
| InChIKey | OILQVRVQAKBSNR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |