About 1,2-dicyclohexyloxybenzene
1,2-dicyclohexyloxybenzene (PubChem CID 67331328) has the molecular formula C18H26O2
and a molecular weight of 274.40 g/mol. Its IUPAC name is 1,2-dicyclohexyloxybenzene.
Molecular Properties
| Compound Name | 1,2-dicyclohexyloxybenzene |
| PubChem CID | 67331328 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1,2-dicyclohexyloxybenzene |
| SMILES | c1ccc(OC2CCCCC2)c(OC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26O2/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2 |
| InChIKey | YWBDMYUZGIIBJY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-dicyclohexyloxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dicyclohexyloxybenzene?
The IUPAC name of 1,2-dicyclohexyloxybenzene (CID 67331328) is 1,2-dicyclohexyloxybenzene.
What is the SMILES notation for 1,2-dicyclohexyloxybenzene?
The canonical SMILES for 1,2-dicyclohexyloxybenzene is c1ccc(OC2CCCCC2)c(OC2CCCCC2)c1.
What is the InChIKey of 1,2-dicyclohexyloxybenzene?
The InChIKey is YWBDMYUZGIIBJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2/c1-3-9-15(10-4-1)19-17-13-7-8-14-18(17)20-16-11-5-2-6-12-16/h7-8,13-16H,1-6,9-12H2.
What are the key properties of 1,2-dicyclohexyloxybenzene?
1,2-dicyclohexyloxybenzene has a molecular weight of 274.40 g/mol, XLogP of 5.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dicyclohexyloxybenzene is sourced from PubChem (CID 67331328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).