About magnesium;cyclohexyloxybenzene;hydride
magnesium;cyclohexyloxybenzene;hydride (PubChem CID 174438663) has the molecular formula C12H18MgO
and a molecular weight of 202.58 g/mol. Its IUPAC name is magnesium;cyclohexyloxybenzene;hydride.
Molecular Properties
| Compound Name | magnesium;cyclohexyloxybenzene;hydride |
| PubChem CID | 174438663 |
| Molecular Formula | C12H18MgO |
| Molecular Weight | 202.58 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | magnesium;cyclohexyloxybenzene;hydride |
| SMILES | [H-].[H-].[Mg+2].c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16O.Mg.2H/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h1,3-4,7-8,12H,2,5-6,9-10H2;;;/q;+2;2*-1 |
| InChIKey | GYHILLWPBQHICU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;cyclohexyloxybenzene;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;cyclohexyloxybenzene;hydride?
The IUPAC name of magnesium;cyclohexyloxybenzene;hydride (CID 174438663) is magnesium;cyclohexyloxybenzene;hydride.
What is the SMILES notation for magnesium;cyclohexyloxybenzene;hydride?
The canonical SMILES for magnesium;cyclohexyloxybenzene;hydride is [H-].[H-].[Mg+2].c1ccc(OC2CCCCC2)cc1.
What is the InChIKey of magnesium;cyclohexyloxybenzene;hydride?
The InChIKey is GYHILLWPBQHICU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.Mg.2H/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;;;/h1,3-4,7-8,12H,2,5-6,9-10H2;;;/q;+2;2*-1.
What are the key properties of magnesium;cyclohexyloxybenzene;hydride?
magnesium;cyclohexyloxybenzene;hydride has a molecular weight of 202.58 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;cyclohexyloxybenzene;hydride is sourced from PubChem (CID 174438663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).