C18H27NO4 — CID 172630786
cyclohexyloxybenzene;methanol;piperidine-2,6-dione (PubChem CID 172630786) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is cyclohexyloxybenzene;methanol;piperidine-2,6-dione.
| Compound Name | cyclohexyloxybenzene;methanol;piperidine-2,6-dione |
|---|---|
| PubChem CID | 172630786 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | cyclohexyloxybenzene;methanol;piperidine-2,6-dione |
| SMILES | CO.O=C1CCCC(=O)N1.c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C12H16O.C5H7NO2.CH4O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-4-2-1-3-5(8)6-4;1-2/h1,3-4,7-8,12H,2,5-6,9-10H2;1-3H2,(H,6,7,8);2H,1H3 |
| InChIKey | ZOFBWIKFADQYIG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|