C16H21NO2 — CID 114940056
7-cycloheptyloxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 114940056) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 7-cycloheptyloxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-cycloheptyloxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 114940056 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 7-cycloheptyloxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OC3CCCCCC3)cc2N1 |
| InChI | InChI=1S/C16H21NO2/c18-16-10-8-12-7-9-14(11-15(12)17-16)19-13-5-3-1-2-4-6-13/h7,9,11,13H,1-6,8,10H2,(H,17,18) |
| InChIKey | SEBLARCXFZJZNV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |