C14H17NO3 — CID 93346628
6-[(1S,2S)-2-hydroxycyclopentyl]oxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 93346628) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-[(1S,2S)-2-hydroxycyclopentyl]oxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(1S,2S)-2-hydroxycyclopentyl]oxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 93346628 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 6-[(1S,2S)-2-hydroxycyclopentyl]oxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(O[C@H]3CCC[C@@H]3O)ccc2N1 |
| InChI | InChI=1S/C14H17NO3/c16-12-2-1-3-13(12)18-10-5-6-11-9(8-10)4-7-14(17)15-11/h5-6,8,12-13,16H,1-4,7H2,(H,15,17)/t12-,13-/m0/s1 |
| InChIKey | PHRBWDPCCNBAKE-STQMWFEESA-N |
| XLogP | 1.86 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |