C13H14O4 — CID 146296856
5-(2-hydroxycyclopentyl)oxy-3H-2-benzofuran-1-one (PubChem CID 146296856) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 5-(2-hydroxycyclopentyl)oxy-3H-2-benzofuran-1-one.
| Compound Name | 5-(2-hydroxycyclopentyl)oxy-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 146296856 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-(2-hydroxycyclopentyl)oxy-3H-2-benzofuran-1-one |
| SMILES | O=C1OCc2cc(OC3CCCC3O)ccc21 |
| InChI | InChI=1S/C13H14O4/c14-11-2-1-3-12(11)17-9-4-5-10-8(6-9)7-16-13(10)15/h4-6,11-12,14H,1-3,7H2 |
| InChIKey | UDINCWVIESXFKV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |