C14H15NO5 — CID 89445047
4-[(1-oxo-3H-2-benzofuran-5-yl)oxy]piperidine-1-carboxylic acid (PubChem CID 89445047) has the molecular formula C14H15NO5 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[(1-oxo-3H-2-benzofuran-5-yl)oxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[(1-oxo-3H-2-benzofuran-5-yl)oxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 89445047 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-[(1-oxo-3H-2-benzofuran-5-yl)oxy]piperidine-1-carboxylic acid |
| SMILES | O=C1OCc2cc(OC3CCN(C(=O)O)CC3)ccc21 |
| InChI | InChI=1S/C14H15NO5/c16-13-12-2-1-11(7-9(12)8-19-13)20-10-3-5-15(6-4-10)14(17)18/h1-2,7,10H,3-6,8H2,(H,17,18) |
| InChIKey | VBTBDTMQZLRTNH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |