C16H20O3 — CID 107684183
5-(2-hydroxycycloheptyl)oxy-2,3-dihydroinden-1-one (PubChem CID 107684183) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 5-(2-hydroxycycloheptyl)oxy-2,3-dihydroinden-1-one.
| Compound Name | 5-(2-hydroxycycloheptyl)oxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 107684183 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 5-(2-hydroxycycloheptyl)oxy-2,3-dihydroinden-1-one |
| SMILES | O=C1CCc2cc(OC3CCCCCC3O)ccc21 |
| InChI | InChI=1S/C16H20O3/c17-14-9-6-11-10-12(7-8-13(11)14)19-16-5-3-1-2-4-15(16)18/h7-8,10,15-16,18H,1-6,9H2 |
| InChIKey | VXRWNYSLCKQLMF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |