C15H20O3 — CID 107684725
5-(2-hydroxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684725) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-(2-hydroxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-(2-hydroxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684725 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-(2-hydroxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | OC1CCc2cc(OC3CCCCC3O)ccc21 |
| InChI | InChI=1S/C15H20O3/c16-13-8-5-10-9-11(6-7-12(10)13)18-15-4-2-1-3-14(15)17/h6-7,9,13-17H,1-5,8H2 |
| InChIKey | GODSZRPRWWPBTI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |