C16H22O3 — CID 107684644
5-(3-methoxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684644) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 5-(3-methoxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-(3-methoxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684644 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 5-(3-methoxycyclohexyl)oxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | COC1CCCC(Oc2ccc3c(c2)CCC3O)C1 |
| InChI | InChI=1S/C16H22O3/c1-18-12-3-2-4-13(10-12)19-14-6-7-15-11(9-14)5-8-16(15)17/h6-7,9,12-13,16-17H,2-5,8,10H2,1H3 |
| InChIKey | SCMMOBXVOULDRO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |