C14H19BrN2O3 — CID 107279013
2-bromo-N'-hydroxy-4-(3-methoxycyclohexyl)oxybenzenecarboximidamide (PubChem CID 107279013) has the molecular formula C14H19BrN2O3 and a molecular weight of 343.22 g/mol. Its IUPAC name is 2-bromo-N'-hydroxy-4-(3-methoxycyclohexyl)oxybenzenecarboximidamide.
| Compound Name | 2-bromo-N'-hydroxy-4-(3-methoxycyclohexyl)oxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107279013 |
| Molecular Formula | C14H19BrN2O3 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 2-bromo-N'-hydroxy-4-(3-methoxycyclohexyl)oxybenzenecarboximidamide |
| SMILES | COC1CCCC(Oc2ccc(/C(N)=N/O)c(Br)c2)C1 |
| InChI | InChI=1S/C14H19BrN2O3/c1-19-9-3-2-4-10(7-9)20-11-5-6-12(13(15)8-11)14(16)17-18/h5-6,8-10,18H,2-4,7H2,1H3,(H2,16,17) |
| InChIKey | NQSWRFGOVBQOLY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|