C13H14O2 — CID 107684782
5-but-2-ynoxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 107684782) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-but-2-ynoxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 5-but-2-ynoxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 107684782 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-but-2-ynoxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | CC#CCOc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C13H14O2/c1-2-3-8-15-11-5-6-12-10(9-11)4-7-13(12)14/h5-6,9,13-14H,4,7-8H2,1H3 |
| InChIKey | AZELZKYBBHHMNA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|