C12H12O3 — CID 63096948
6-but-2-ynoxy-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 63096948) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 6-but-2-ynoxy-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 6-but-2-ynoxy-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 63096948 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 6-but-2-ynoxy-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | CC#CCOc1ccc2c(c1)OCC2O |
| InChI | InChI=1S/C12H12O3/c1-2-3-6-14-9-4-5-10-11(13)8-15-12(10)7-9/h4-5,7,11,13H,6,8H2,1H3 |
| InChIKey | GHONJDRJGFZBBQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|