C11H11F3O3 — CID 64566719
6-(3,3,3-trifluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 64566719) has the molecular formula C11H11F3O3 and a molecular weight of 248.20 g/mol. Its IUPAC name is 6-(3,3,3-trifluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 6-(3,3,3-trifluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 64566719 |
| Molecular Formula | C11H11F3O3 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 6-(3,3,3-trifluoropropoxy)-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | OC1COc2cc(OCCC(F)(F)F)ccc21 |
| InChI | InChI=1S/C11H11F3O3/c12-11(13,14)3-4-16-7-1-2-8-9(15)6-17-10(8)5-7/h1-2,5,9,15H,3-4,6H2 |
| InChIKey | BQLCWYQAWJGPPF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |