C17H14O3 — CID 63096784
6-(3-phenylprop-2-ynoxy)-2,3-dihydro-1-benzofuran-3-ol (PubChem CID 63096784) has the molecular formula C17H14O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-(3-phenylprop-2-ynoxy)-2,3-dihydro-1-benzofuran-3-ol.
| Compound Name | 6-(3-phenylprop-2-ynoxy)-2,3-dihydro-1-benzofuran-3-ol |
|---|---|
| PubChem CID | 63096784 |
| Molecular Formula | C17H14O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 6-(3-phenylprop-2-ynoxy)-2,3-dihydro-1-benzofuran-3-ol |
| SMILES | OC1COc2cc(OCC#Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C17H14O3/c18-16-12-20-17-11-14(8-9-15(16)17)19-10-4-7-13-5-2-1-3-6-13/h1-3,5-6,8-9,11,16,18H,10,12H2 |
| InChIKey | TZYFZPWBVBDLMW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|